C9H17N2O+ — CID 124784448
(5S,9aR)-5-methyl-1,2,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-5-ium-3-one (PubChem CID 124784448) has the molecular formula C9H17N2O+ and a molecular weight of 169.25 g/mol. Its IUPAC name is (5S,9aR)-5-methyl-1,2,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-5-ium-3-one.
| Compound Name | (5S,9aR)-5-methyl-1,2,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-5-ium-3-one |
|---|---|
| PubChem CID | 124784448 |
| Molecular Formula | C9H17N2O+ |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (5S,9aR)-5-methyl-1,2,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-5-ium-3-one |
| SMILES | C[N@@+]12CCCC[C@@H]1CNC(=O)C2 |
| InChI | InChI=1S/C9H16N2O/c1-11-5-3-2-4-8(11)6-10-9(12)7-11/h8H,2-7H2,1H3/p+1/t8-,11+/m1/s1 |
| InChIKey | KKRNKTUUHNVAIL-KCJUWKMLSA-O |
| XLogP | 0.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|