C17H16O3 — CID 124784888
(1S,2R,3S,4R,5R,7R,9S,11R,12S,15R)-8-hydroxyheptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione (PubChem CID 124784888) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1S,2R,3S,4R,5R,7R,9S,11R,12S,15R)-8-hydroxyheptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione.
| Compound Name | (1S,2R,3S,4R,5R,7R,9S,11R,12S,15R)-8-hydroxyheptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione |
|---|---|
| PubChem CID | 124784888 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (1S,2R,3S,4R,5R,7R,9S,11R,12S,15R)-8-hydroxyheptacyclo[9.6.0.02,9.03,7.04,17.05,15.012,16]heptadec-13-ene-6,10-dione |
| SMILES | O=C1[C@H]2[C@H]3C4C5[C@@H](C=C[C@@H]52)[C@H]2C(=O)[C@H]5C(O)[C@@H]1[C@H]3[C@@H]5[C@@H]42 |
| InChI | InChI=1S/C17H16O3/c18-15-6-3-1-2-4-5(3)8-9(6)11-12-10(8)7(4)16(19)14(12)17(20)13(11)15/h1-14,17,20H/t3-,4+,5?,6-,7-,8?,9-,10+,11+,12-,13+,14-,17?/m1/s1 |
| InChIKey | BUXVXPFIGQLURW-QIQUQRCHSA-N |
| XLogP | 0.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|