C18H15NO3 — CID 124785091
(1S,2S,6R,7S,8S,10S)-4-phenyl-4-azatetracyclo[5.4.2.02,6.08,10]tridec-12-ene-3,5,11-trione (PubChem CID 124785091) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is (1S,2S,6R,7S,8S,10S)-4-phenyl-4-azatetracyclo[5.4.2.02,6.08,10]tridec-12-ene-3,5,11-trione.
| Compound Name | (1S,2S,6R,7S,8S,10S)-4-phenyl-4-azatetracyclo[5.4.2.02,6.08,10]tridec-12-ene-3,5,11-trione |
|---|---|
| PubChem CID | 124785091 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (1S,2S,6R,7S,8S,10S)-4-phenyl-4-azatetracyclo[5.4.2.02,6.08,10]tridec-12-ene-3,5,11-trione |
| SMILES | O=C1[C@H]2C=C[C@@H]([C@@H]3C[C@H]13)[C@H]1C(=O)N(c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C18H15NO3/c20-16-11-7-6-10(12-8-13(12)16)14-15(11)18(22)19(17(14)21)9-4-2-1-3-5-9/h1-7,10-15H,8H2/t10-,11-,12-,13-,14+,15-/m0/s1 |
| InChIKey | IPILPBGNJMMELT-UQGHGMQMSA-N |
| XLogP | 1.81 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|