C17H28N2O4 — CID 124785555
[(3aS,7aS)-5-(oxan-4-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-morpholin-4-ylmethanone (PubChem CID 124785555) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is [(3aS,7aS)-5-(oxan-4-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aS,7aS)-5-(oxan-4-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 124785555 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | [(3aS,7aS)-5-(oxan-4-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)[C@]12CCO[C@H]1CCN(C1CCOCC1)C2 |
| InChI | InChI=1S/C17H28N2O4/c20-16(18-6-11-22-12-7-18)17-4-10-23-15(17)1-5-19(13-17)14-2-8-21-9-3-14/h14-15H,1-13H2/t15-,17-/m0/s1 |
| InChIKey | DNWKFTPIXSLFKN-RDJZCZTQSA-N |
| XLogP | 0.51 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |