C21H13ClF2N4O — CID 124786561
1-(4-chlorophenyl)-N,5-bis(4-fluorophenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 124786561) has the molecular formula C21H13ClF2N4O and a molecular weight of 410.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,5-bis(4-fluorophenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N,5-bis(4-fluorophenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 124786561 |
| Molecular Formula | C21H13ClF2N4O |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 1-(4-chlorophenyl)-N,5-bis(4-fluorophenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1nc(-c2ccc(F)cc2)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C21H13ClF2N4O/c22-14-3-11-18(12-4-14)28-20(13-1-5-15(23)6-2-13)26-19(27-28)21(29)25-17-9-7-16(24)8-10-17/h1-12H,(H,25,29) |
| InChIKey | VLOOOWSDUIJFTK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |