C24H34N2O2 — CID 124786858
[6-[(1S)-2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-hydroxyethyl]-3,4-dihydro-2H-quinolin-1-yl]-cyclopropylmethanone (PubChem CID 124786858) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is [6-[(1S)-2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-hydroxyethyl]-3,4-dihydro-2H-quinolin-1-yl]-cyclopropylmethanone.
| Compound Name | [6-[(1S)-2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-hydroxyethyl]-3,4-dihydro-2H-quinolin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 124786858 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | [6-[(1S)-2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-hydroxyethyl]-3,4-dihydro-2H-quinolin-1-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CCCc2cc([C@H](O)CN3CC[C@@H]4CCCC[C@H]4C3)ccc21 |
| InChI | InChI=1S/C24H34N2O2/c27-23(16-25-13-11-17-4-1-2-5-21(17)15-25)20-9-10-22-19(14-20)6-3-12-26(22)24(28)18-7-8-18/h9-10,14,17-18,21,23,27H,1-8,11-13,15-16H2/t17-,21-,23+/m0/s1 |
| InChIKey | FCLGTCLZAQCHJG-JWNTYJGQSA-N |
| XLogP | 3.92 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |