C18H22N2O3 — CID 124787557
cyclopent-3-en-1-yl-[(8S)-8-pyridin-2-yloxy-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone (PubChem CID 124787557) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[(8S)-8-pyridin-2-yloxy-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone.
| Compound Name | cyclopent-3-en-1-yl-[(8S)-8-pyridin-2-yloxy-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone |
|---|---|
| PubChem CID | 124787557 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | cyclopent-3-en-1-yl-[(8S)-8-pyridin-2-yloxy-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone |
| SMILES | O=C(C1CC=CC1)N1CC2(C[C@@H](Oc3ccccn3)CCO2)C1 |
| InChI | InChI=1S/C18H22N2O3/c21-17(14-5-1-2-6-14)20-12-18(13-20)11-15(8-10-22-18)23-16-7-3-4-9-19-16/h1-4,7,9,14-15H,5-6,8,10-13H2/t15-/m0/s1 |
| InChIKey | CRQGRVAVAYQKSH-HNNXBMFYSA-N |
| XLogP | 2.19 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|