C21H27N3O2 — CID 124787744
[(5aS,9aR)-4-(cyclopropylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1H-indol-5-yl)methanone (PubChem CID 124787744) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is [(5aS,9aR)-4-(cyclopropylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1H-indol-5-yl)methanone.
| Compound Name | [(5aS,9aR)-4-(cyclopropylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1H-indol-5-yl)methanone |
|---|---|
| PubChem CID | 124787744 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | [(5aS,9aR)-4-(cyclopropylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepin-8-yl]-(1H-indol-5-yl)methanone |
| SMILES | O=C(c1ccc2[nH]ccc2c1)N1CC[C@H]2CN(CC3CC3)CCO[C@H]2C1 |
| InChI | InChI=1S/C21H27N3O2/c25-21(17-3-4-19-16(11-17)5-7-22-19)24-8-6-18-13-23(12-15-1-2-15)9-10-26-20(18)14-24/h3-5,7,11,15,18,20,22H,1-2,6,8-10,12-14H2/t18-,20-/m0/s1 |
| InChIKey | FDKUDFCHXRRHLU-ICSRJNTNSA-N |
| XLogP | 2.74 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |