C19H23NO4S — CID 124789121
methyl 4-[(2S)-2-hydroxy-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propoxy]benzoate (PubChem CID 124789121) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is methyl 4-[(2S)-2-hydroxy-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propoxy]benzoate.
| Compound Name | methyl 4-[(2S)-2-hydroxy-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propoxy]benzoate |
|---|---|
| PubChem CID | 124789121 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | methyl 4-[(2S)-2-hydroxy-3-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]propoxy]benzoate |
| SMILES | COC(=O)c1ccc(OC[C@@H](O)CN2CCC[C@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C19H23NO4S/c1-23-19(22)14-6-8-16(9-7-14)24-13-15(21)12-20-10-2-4-17(20)18-5-3-11-25-18/h3,5-9,11,15,17,21H,2,4,10,12-13H2,1H3/t15-,17-/m0/s1 |
| InChIKey | HEHFHINGENINEB-RDJZCZTQSA-N |
| XLogP | 3.11 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |