C16H20N4O2S — CID 124789286
(4aR,7R,7aR)-4-pyrazin-2-yl-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 124789286) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is (4aR,7R,7aR)-4-pyrazin-2-yl-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aR,7R,7aR)-4-pyrazin-2-yl-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 124789286 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (4aR,7R,7aR)-4-pyrazin-2-yl-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | c1cnc(N2CCO[C@@H]3[C@@H](COCc4nccs4)CC[C@H]32)cn1 |
| InChI | InChI=1S/C16H20N4O2S/c1-2-13-16(12(1)10-21-11-15-19-5-8-23-15)22-7-6-20(13)14-9-17-3-4-18-14/h3-5,8-9,12-13,16H,1-2,6-7,10-11H2/t12-,13-,16-/m1/s1 |
| InChIKey | CWCOHGRFXBFCCC-XJKCOSOUSA-N |
| XLogP | 2.13 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |