C23H32N2O6S — CID 124789675
methyl (2S,3aS,7aR)-1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 124789675) has the molecular formula C23H32N2O6S and a molecular weight of 464.58 g/mol. Its IUPAC name is methyl (2S,3aS,7aR)-1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | methyl (2S,3aS,7aR)-1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 124789675 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | methyl (2S,3aS,7aR)-1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CCCC[C@H]2N1C(=O)c1ccc(S(=O)(=O)N2C[C@@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C23H32N2O6S/c1-15-13-24(14-16(2)31-15)32(28,29)19-10-8-17(9-11-19)22(26)25-20-7-5-4-6-18(20)12-21(25)23(27)30-3/h8-11,15-16,18,20-21H,4-7,12-14H2,1-3H3/t15-,16+,18-,20+,21-/m0/s1 |
| InChIKey | JFBSZQVUSUFLFE-NRVIKUFQSA-N |
| XLogP | 2.43 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |