C16H16ClNO3S — CID 124790502
(5-chloro-1-benzofuran-2-yl)-[(7S)-7-methoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone (PubChem CID 124790502) has the molecular formula C16H16ClNO3S and a molecular weight of 337.83 g/mol. Its IUPAC name is (5-chloro-1-benzofuran-2-yl)-[(7S)-7-methoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone.
| Compound Name | (5-chloro-1-benzofuran-2-yl)-[(7S)-7-methoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone |
|---|---|
| PubChem CID | 124790502 |
| Molecular Formula | C16H16ClNO3S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | (5-chloro-1-benzofuran-2-yl)-[(7S)-7-methoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone |
| SMILES | CO[C@@H]1CSC2(C1)CN(C(=O)c1cc3cc(Cl)ccc3o1)C2 |
| InChI | InChI=1S/C16H16ClNO3S/c1-20-12-6-16(22-7-12)8-18(9-16)15(19)14-5-10-4-11(17)2-3-13(10)21-14/h2-5,12H,6-9H2,1H3/t12-/m0/s1 |
| InChIKey | JGYQSECPCBQWIA-LBPRGKRZSA-N |
| XLogP | 3.43 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |