C16H23N5O2 — CID 124790941
(3R,3aR,6aR)-3-(2-ethoxyethyl)-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 124790941) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (3R,3aR,6aR)-3-(2-ethoxyethyl)-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (3R,3aR,6aR)-3-(2-ethoxyethyl)-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 124790941 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (3R,3aR,6aR)-3-(2-ethoxyethyl)-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | CCOCC[C@H]1CO[C@H]2CN(c3cc(C)nc4ncnn34)C[C@@H]12 |
| InChI | InChI=1S/C16H23N5O2/c1-3-22-5-4-12-9-23-14-8-20(7-13(12)14)15-6-11(2)19-16-17-10-18-21(15)16/h6,10,12-14H,3-5,7-9H2,1-2H3/t12-,13-,14-/m0/s1 |
| InChIKey | QBBMDYPVYLDPHH-IHRRRGAJSA-N |
| XLogP | 1.31 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|