C16H16N4O2S — CID 124791057
[(7S)-7-pyridin-2-yloxy-5-thia-2-azaspiro[3.4]octan-2-yl]-pyrimidin-4-ylmethanone (PubChem CID 124791057) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is [(7S)-7-pyridin-2-yloxy-5-thia-2-azaspiro[3.4]octan-2-yl]-pyrimidin-4-ylmethanone.
| Compound Name | [(7S)-7-pyridin-2-yloxy-5-thia-2-azaspiro[3.4]octan-2-yl]-pyrimidin-4-ylmethanone |
|---|---|
| PubChem CID | 124791057 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | [(7S)-7-pyridin-2-yloxy-5-thia-2-azaspiro[3.4]octan-2-yl]-pyrimidin-4-ylmethanone |
| SMILES | O=C(c1ccncn1)N1CC2(C[C@H](Oc3ccccn3)CS2)C1 |
| InChI | InChI=1S/C16H16N4O2S/c21-15(13-4-6-17-11-19-13)20-9-16(10-20)7-12(8-23-16)22-14-3-1-2-5-18-14/h1-6,11-12H,7-10H2/t12-/m0/s1 |
| InChIKey | FUQOWKBTRKCCDW-LBPRGKRZSA-N |
| XLogP | 1.65 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |