C20H19F2N3O — CID 124791810
(1'R,2R,4'R)-7'-[(3,4-difluorophenyl)methyl]spiro[1,3-dihydroquinazoline-2,2'-7-azabicyclo[2.2.1]heptane]-4-one (PubChem CID 124791810) has the molecular formula C20H19F2N3O and a molecular weight of 355.39 g/mol. Its IUPAC name is (1'R,2R,4'R)-7'-[(3,4-difluorophenyl)methyl]spiro[1,3-dihydroquinazoline-2,2'-7-azabicyclo[2.2.1]heptane]-4-one.
| Compound Name | (1'R,2R,4'R)-7'-[(3,4-difluorophenyl)methyl]spiro[1,3-dihydroquinazoline-2,2'-7-azabicyclo[2.2.1]heptane]-4-one |
|---|---|
| PubChem CID | 124791810 |
| Molecular Formula | C20H19F2N3O |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (1'R,2R,4'R)-7'-[(3,4-difluorophenyl)methyl]spiro[1,3-dihydroquinazoline-2,2'-7-azabicyclo[2.2.1]heptane]-4-one |
| SMILES | O=C1N[C@@]2(C[C@H]3CC[C@H]2N3Cc2ccc(F)c(F)c2)Nc2ccccc21 |
| InChI | InChI=1S/C20H19F2N3O/c21-15-7-5-12(9-16(15)22)11-25-13-6-8-18(25)20(10-13)23-17-4-2-1-3-14(17)19(26)24-20/h1-5,7,9,13,18,23H,6,8,10-11H2,(H,24,26)/t13-,18-,20-/m1/s1 |
| InChIKey | FWIHCLCSJOVVKI-CFSSXQINSA-N |
| XLogP | 3.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |