C16H16F2N2O2 — CID 124791947
(3,5-difluorophenyl)-[(4R)-4-methoxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone (PubChem CID 124791947) has the molecular formula C16H16F2N2O2 and a molecular weight of 306.31 g/mol. Its IUPAC name is (3,5-difluorophenyl)-[(4R)-4-methoxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone.
| Compound Name | (3,5-difluorophenyl)-[(4R)-4-methoxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone |
|---|---|
| PubChem CID | 124791947 |
| Molecular Formula | C16H16F2N2O2 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (3,5-difluorophenyl)-[(4R)-4-methoxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methanone |
| SMILES | CO[C@H]1CN(C(=O)c2cc(F)cc(F)c2)Cc2cccn2C1 |
| InChI | InChI=1S/C16H16F2N2O2/c1-22-15-9-19-4-2-3-14(19)8-20(10-15)16(21)11-5-12(17)7-13(18)6-11/h2-7,15H,8-10H2,1H3/t15-/m1/s1 |
| InChIKey | OEECWNJFENMSOX-OAHLLOKOSA-N |
| XLogP | 2.44 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |