About 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine
2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine (PubChem CID 124792317) has the molecular formula C16H19N3O
and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine.
Molecular Properties
| Compound Name | 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine |
| PubChem CID | 124792317 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine |
| SMILES | CO[C@@H]1CCN(c2ncccn2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H19N3O/c1-20-15-8-11-19(16-17-9-5-10-18-16)14(15)12-13-6-3-2-4-7-13/h2-7,9-10,14-15H,8,11-12H2,1H3/t14-,15-/m1/s1 |
| InChIKey | SELOKMWGJNHJTF-HUUCEWRRSA-N |
| XLogP | 2.31 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine?
The IUPAC name of 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine (CID 124792317) is 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine.
What is the SMILES notation for 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine?
The canonical SMILES for 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine is CO[C@@H]1CCN(c2ncccn2)[C@@H]1Cc1ccccc1.
What is the InChIKey of 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine?
The InChIKey is SELOKMWGJNHJTF-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H19N3O/c1-20-15-8-11-19(16-17-9-5-10-18-16)14(15)12-13-6-3-2-4-7-13/h2-7,9-10,14-15H,8,11-12H2,1H3/t14-,15-/m1/s1.
What are the key properties of 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine?
2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine has a molecular weight of 269.35 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,3R)-2-benzyl-3-methoxypyrrolidin-1-yl]pyrimidine is sourced from PubChem (CID 124792317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).