C20H24N2O2S — CID 124792962
[(2R,3S)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 124792962) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is [(2R,3S)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [(2R,3S)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 124792962 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [(2R,3S)-2-benzyl-3-morpholin-4-ylpyrrolidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CC[C@H](N2CCOCC2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H24N2O2S/c23-20(17-7-13-25-15-17)22-8-6-18(21-9-11-24-12-10-21)19(22)14-16-4-2-1-3-5-16/h1-5,7,13,15,18-19H,6,8-12,14H2/t18-,19+/m0/s1 |
| InChIKey | LGGJVVJXWOAWPV-RBUKOAKNSA-N |
| XLogP | 2.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |