C17H22N2O3S — CID 124793711
[(3aS,6R,7aS)-4-(thiophene-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl]-pyrrolidin-1-ylmethanone (PubChem CID 124793711) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is [(3aS,6R,7aS)-4-(thiophene-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3aS,6R,7aS)-4-(thiophene-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 124793711 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(3aS,6R,7aS)-4-(thiophene-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C([C@@H]1C[C@@H]2OCC[C@@H]2N(C(=O)c2ccsc2)C1)N1CCCC1 |
| InChI | InChI=1S/C17H22N2O3S/c20-16(18-5-1-2-6-18)13-9-15-14(3-7-22-15)19(10-13)17(21)12-4-8-23-11-12/h4,8,11,13-15H,1-3,5-7,9-10H2/t13-,14+,15+/m1/s1 |
| InChIKey | ORAFTVRXGXBDJM-ILXRZTDVSA-N |
| XLogP | 1.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |