C15H16FN5O2S — CID 124794069
[(5aS,8aR)-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 124794069) has the molecular formula C15H16FN5O2S and a molecular weight of 349.39 g/mol. Its IUPAC name is [(5aS,8aR)-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(5aS,8aR)-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 124794069 |
| Molecular Formula | C15H16FN5O2S |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [(5aS,8aR)-7-(5-fluoropyrimidin-2-yl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-4-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1CCO[C@H]2CN(c3ncc(F)cn3)C[C@H]2C1 |
| InChI | InChI=1S/C15H16FN5O2S/c16-11-3-17-15(18-4-11)21-6-10-5-20(1-2-23-13(10)7-21)14(22)12-8-24-9-19-12/h3-4,8-10,13H,1-2,5-7H2/t10-,13+/m1/s1 |
| InChIKey | QDNNWJQBJDNHFN-MFKMUULPSA-N |
| XLogP | 1.05 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |