C18H21N3O4 — CID 124795434
furan-3-yl-[(8S)-8-(2-pyrimidin-2-yloxyethyl)-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone (PubChem CID 124795434) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is furan-3-yl-[(8S)-8-(2-pyrimidin-2-yloxyethyl)-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone.
| Compound Name | furan-3-yl-[(8S)-8-(2-pyrimidin-2-yloxyethyl)-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone |
|---|---|
| PubChem CID | 124795434 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | furan-3-yl-[(8S)-8-(2-pyrimidin-2-yloxyethyl)-5-oxa-2-azaspiro[3.5]nonan-2-yl]methanone |
| SMILES | O=C(c1ccoc1)N1CC2(C[C@H](CCOc3ncccn3)CCO2)C1 |
| InChI | InChI=1S/C18H21N3O4/c22-16(15-4-7-23-11-15)21-12-18(13-21)10-14(3-9-25-18)2-8-24-17-19-5-1-6-20-17/h1,4-7,11,14H,2-3,8-10,12-13H2/t14-/m1/s1 |
| InChIKey | VNKPNLKSQZBCJL-CQSZACIVSA-N |
| XLogP | 2.16 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |