C16H19F2NO3 — CID 124795595
[(3S,3aS,6aS)-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(3,5-difluorophenyl)methanone (PubChem CID 124795595) has the molecular formula C16H19F2NO3 and a molecular weight of 311.33 g/mol. Its IUPAC name is [(3S,3aS,6aS)-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(3,5-difluorophenyl)methanone.
| Compound Name | [(3S,3aS,6aS)-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 124795595 |
| Molecular Formula | C16H19F2NO3 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | [(3S,3aS,6aS)-3-(2-methoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(3,5-difluorophenyl)methanone |
| SMILES | COCC[C@@H]1CO[C@@H]2CN(C(=O)c3cc(F)cc(F)c3)C[C@H]12 |
| InChI | InChI=1S/C16H19F2NO3/c1-21-3-2-10-9-22-15-8-19(7-14(10)15)16(20)11-4-12(17)6-13(18)5-11/h4-6,10,14-15H,2-3,7-9H2,1H3/t10-,14-,15-/m1/s1 |
| InChIKey | QDZAJBBIGZRCRM-VCTAVGKDSA-N |
| XLogP | 2.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |