C18H20N4O3 — CID 124796510
[(8S)-8-(pyridin-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]-pyrimidin-4-ylmethanone (PubChem CID 124796510) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is [(8S)-8-(pyridin-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]-pyrimidin-4-ylmethanone.
| Compound Name | [(8S)-8-(pyridin-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]-pyrimidin-4-ylmethanone |
|---|---|
| PubChem CID | 124796510 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | [(8S)-8-(pyridin-4-ylmethoxy)-5-oxa-2-azaspiro[3.5]nonan-2-yl]-pyrimidin-4-ylmethanone |
| SMILES | O=C(c1ccncn1)N1CC2(C[C@@H](OCc3ccncc3)CCO2)C1 |
| InChI | InChI=1S/C18H20N4O3/c23-17(16-3-7-20-13-21-16)22-11-18(12-22)9-15(4-8-25-18)24-10-14-1-5-19-6-2-14/h1-3,5-7,13,15H,4,8-12H2/t15-/m0/s1 |
| InChIKey | YCAOPTGUJDBIET-HNNXBMFYSA-N |
| XLogP | 1.46 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |