C18H21N5O — CID 124797364
(3aS,7aS)-2-[(6-methyl-2-pyridinyl)methyl]-5-pyrimidin-5-yl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 124797364) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is (3aS,7aS)-2-[(6-methyl-2-pyridinyl)methyl]-5-pyrimidin-5-yl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aS,7aS)-2-[(6-methyl-2-pyridinyl)methyl]-5-pyrimidin-5-yl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 124797364 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (3aS,7aS)-2-[(6-methyl-2-pyridinyl)methyl]-5-pyrimidin-5-yl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | Cc1cccc(CN2C[C@H]3CCN(c4cncnc4)C(=O)[C@@H]3C2)n1 |
| InChI | InChI=1S/C18H21N5O/c1-13-3-2-4-15(21-13)10-22-9-14-5-6-23(18(24)17(14)11-22)16-7-19-12-20-8-16/h2-4,7-8,12,14,17H,5-6,9-11H2,1H3/t14-,17-/m1/s1 |
| InChIKey | YGJCREIEXTYITE-RHSMWYFYSA-N |
| XLogP | 1.66 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |