C18H25N3O2S — CID 124797600
3-[[(3aR,6aR)-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]-5-methyl-1,2-oxazole (PubChem CID 124797600) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 3-[[(3aR,6aR)-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]-5-methyl-1,2-oxazole.
| Compound Name | 3-[[(3aR,6aR)-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 124797600 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-[[(3aR,6aR)-3a-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]methyl]-5-methyl-1,2-oxazole |
| SMILES | Cc1cc(CN2C[C@@H]3CCC[C@]3(COCc3csc(C)n3)C2)no1 |
| InChI | InChI=1S/C18H25N3O2S/c1-13-6-16(20-23-13)8-21-7-15-4-3-5-18(15,11-21)12-22-9-17-10-24-14(2)19-17/h6,10,15H,3-5,7-9,11-12H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | IPNRFPBGHCCKRF-MAUKXSAKSA-N |
| XLogP | 3.57 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |