C18H27ClN4O2S — CID 124797704
4-chloro-N-[3-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]methyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]benzenesulfonamide (PubChem CID 124797704) has the molecular formula C18H27ClN4O2S and a molecular weight of 398.96 g/mol. Its IUPAC name is 4-chloro-N-[3-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]methyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[3-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]methyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 124797704 |
| Molecular Formula | C18H27ClN4O2S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-chloro-N-[3-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]methyl]-2,4-dihydro-1H-1,3,5-triazin-6-yl]benzenesulfonamide |
| SMILES | C[C@@H]1[C@H](CN2CN=C(NS(=O)(=O)c3ccc(Cl)cc3)NC2)CCC[C@H]1C |
| InChI | InChI=1S/C18H27ClN4O2S/c1-13-4-3-5-15(14(13)2)10-23-11-20-18(21-12-23)22-26(24,25)17-8-6-16(19)7-9-17/h6-9,13-15H,3-5,10-12H2,1-2H3,(H2,20,21,22)/t13-,14+,15+/m1/s1 |
| InChIKey | ZPGJLPMCWHFEBI-ILXRZTDVSA-N |
| XLogP | 2.87 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |