C23H28N2O2 — CID 124800238
(1S,9S)-12-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 124800238) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (1S,9S)-12-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (1S,9S)-12-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 124800238 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (1S,9S)-12-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-6,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | COc1cccc(CN2[C@H]3CC[C@H]2c2cccnc2C3)c1OC1CCCC1 |
| InChI | InChI=1S/C23H28N2O2/c1-26-22-10-4-6-16(23(22)27-18-7-2-3-8-18)15-25-17-11-12-21(25)19-9-5-13-24-20(19)14-17/h4-6,9-10,13,17-18,21H,2-3,7-8,11-12,14-15H2,1H3/t17-,21-/m0/s1 |
| InChIKey | VBAZFRHWKXUWDK-UWJYYQICSA-N |
| XLogP | 4.67 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |