C13H12O — CID 124801071
(2S,3S,4S,7R)-10-methoxytetracyclo[6.4.0.02,4.03,7]dodeca-1(8),5,9,11-tetraene (PubChem CID 124801071) has the molecular formula C13H12O and a molecular weight of 184.24 g/mol. Its IUPAC name is (2S,3S,4S,7R)-10-methoxytetracyclo[6.4.0.02,4.03,7]dodeca-1(8),5,9,11-tetraene.
| Compound Name | (2S,3S,4S,7R)-10-methoxytetracyclo[6.4.0.02,4.03,7]dodeca-1(8),5,9,11-tetraene |
|---|---|
| PubChem CID | 124801071 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (2S,3S,4S,7R)-10-methoxytetracyclo[6.4.0.02,4.03,7]dodeca-1(8),5,9,11-tetraene |
| SMILES | COc1ccc2c(c1)[C@@H]1C=C[C@@H]3[C@H]2[C@H]31 |
| InChI | InChI=1S/C13H12O/c1-14-7-2-3-8-11(6-7)9-4-5-10-12(8)13(9)10/h2-6,9-10,12-13H,1H3/t9-,10+,12-,13-/m0/s1 |
| InChIKey | JXGLXMDIQUFANU-LFSVMHDDSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|