C16H25N3O3 — CID 124801429
(2S,3aR,7aS)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N,N-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 124801429) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (2S,3aR,7aS)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N,N-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2S,3aR,7aS)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N,N-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 124801429 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (2S,3aR,7aS)-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N,N-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | Cc1noc(C)c1CN1CC[C@@H]2C[C@@H](C(=O)N(C)C)O[C@@H]2C1 |
| InChI | InChI=1S/C16H25N3O3/c1-10-13(11(2)22-17-10)8-19-6-5-12-7-14(16(20)18(3)4)21-15(12)9-19/h12,14-15H,5-9H2,1-4H3/t12-,14+,15-/m1/s1 |
| InChIKey | BTNRUKKABYUNBT-VHDGCEQUSA-N |
| XLogP | 1.36 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |