C19H18FN5O — CID 124801662
(3aS,4S,6aR)-2-(5-fluoropyrimidin-2-yl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one (PubChem CID 124801662) has the molecular formula C19H18FN5O and a molecular weight of 351.38 g/mol. Its IUPAC name is (3aS,4S,6aR)-2-(5-fluoropyrimidin-2-yl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one.
| Compound Name | (3aS,4S,6aR)-2-(5-fluoropyrimidin-2-yl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
|---|---|
| PubChem CID | 124801662 |
| Molecular Formula | C19H18FN5O |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (3aS,4S,6aR)-2-(5-fluoropyrimidin-2-yl)-2'-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-1H-imidazole]-5'-one |
| SMILES | O=C1NC(c2ccccc2)=N[C@]12CC[C@H]1CN(c3ncc(F)cn3)C[C@H]12 |
| InChI | InChI=1S/C19H18FN5O/c20-14-8-21-18(22-9-14)25-10-13-6-7-19(15(13)11-25)17(26)23-16(24-19)12-4-2-1-3-5-12/h1-5,8-9,13,15H,6-7,10-11H2,(H,23,24,26)/t13-,15+,19-/m0/s1 |
| InChIKey | STUNQGPVWUQNAS-OHNRDTAOSA-N |
| XLogP | 1.78 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |