C17H21FN2O4S — CID 124802442
1-[[(3R,3aR,6aR)-5-(2-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one (PubChem CID 124802442) has the molecular formula C17H21FN2O4S and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-[[(3R,3aR,6aR)-5-(2-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[(3R,3aR,6aR)-5-(2-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 124802442 |
| Molecular Formula | C17H21FN2O4S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1-[[(3R,3aR,6aR)-5-(2-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C[C@@H]1CO[C@H]2CN(S(=O)(=O)c3ccccc3F)C[C@@H]12 |
| InChI | InChI=1S/C17H21FN2O4S/c18-14-4-1-2-5-16(14)25(22,23)20-9-13-12(11-24-15(13)10-20)8-19-7-3-6-17(19)21/h1-2,4-5,12-13,15H,3,6-11H2/t12-,13+,15+/m1/s1 |
| InChIKey | NYLUHWIOMOBWOF-IPYPFGDCSA-N |
| XLogP | 1.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |