About (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane
(8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane (PubChem CID 124803192) has the molecular formula C16H20N4O2S
and a molecular weight of 332.43 g/mol. Its IUPAC name is (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane.
Molecular Properties
| Compound Name | (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane |
| PubChem CID | 124803192 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane |
| SMILES | Cc1csc(CN2CC3(C[C@H](Oc4ncccn4)CCO3)C2)n1 |
| InChI | InChI=1S/C16H20N4O2S/c1-12-9-23-14(19-12)8-20-10-16(11-20)7-13(3-6-21-16)22-15-17-4-2-5-18-15/h2,4-5,9,13H,3,6-8,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | OZGMDLKEJNAOMU-CYBMUJFWSA-N |
| XLogP | 2.05 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane?
The IUPAC name of (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane (CID 124803192) is (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane.
What is the SMILES notation for (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane?
The canonical SMILES for (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane is Cc1csc(CN2CC3(C[C@H](Oc4ncccn4)CCO3)C2)n1.
What is the InChIKey of (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane?
The InChIKey is OZGMDLKEJNAOMU-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H20N4O2S/c1-12-9-23-14(19-12)8-20-10-16(11-20)7-13(3-6-21-16)22-15-17-4-2-5-18-15/h2,4-5,9,13H,3,6-8,10-11H2,1H3/t13-/m1/s1.
What are the key properties of (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane?
(8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane has a molecular weight of 332.43 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrimidin-2-yloxy-5-oxa-2-azaspiro[3.5]nonane is sourced from PubChem (CID 124803192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).