C22H27NO6 — CID 124804211
N-[(4aR,6R,7S,8S,8aR)-8-hydroxy-2,2-dimethyl-6-(naphthalen-2-ylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 124804211) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[(4aR,6R,7S,8S,8aR)-8-hydroxy-2,2-dimethyl-6-(naphthalen-2-ylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(4aR,6R,7S,8S,8aR)-8-hydroxy-2,2-dimethyl-6-(naphthalen-2-ylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 124804211 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[(4aR,6R,7S,8S,8aR)-8-hydroxy-2,2-dimethyl-6-(naphthalen-2-ylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@H](OCc2ccc3ccccc3c2)O[C@@H]2COC(C)(C)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C22H27NO6/c1-13(24)23-18-19(25)20-17(12-27-22(2,3)29-20)28-21(18)26-11-14-8-9-15-6-4-5-7-16(15)10-14/h4-10,17-21,25H,11-12H2,1-3H3,(H,23,24)/t17-,18+,19+,20+,21-/m1/s1 |
| InChIKey | YNCSHLXKHJPHEP-NXNFSMPISA-N |
| XLogP | 2.10 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |