C12H15N3O4 — CID 124804647
(3aS,6R,6aS)-N-methyl-4-(1,2-oxazole-5-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 124804647) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is (3aS,6R,6aS)-N-methyl-4-(1,2-oxazole-5-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aS,6R,6aS)-N-methyl-4-(1,2-oxazole-5-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 124804647 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (3aS,6R,6aS)-N-methyl-4-(1,2-oxazole-5-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | CNC(=O)[C@@H]1CN(C(=O)c2ccno2)[C@H]2CCO[C@@H]12 |
| InChI | InChI=1S/C12H15N3O4/c1-13-11(16)7-6-15(8-3-5-18-10(7)8)12(17)9-2-4-14-19-9/h2,4,7-8,10H,3,5-6H2,1H3,(H,13,16)/t7-,8+,10+/m1/s1 |
| InChIKey | WIJHQPPNRDDNKB-WEDXCCLWSA-N |
| XLogP | -0.35 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |