C17H25N3O3S — CID 124804747
[(2R,3aR,7aR)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(oxazinan-2-yl)methanone (PubChem CID 124804747) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is [(2R,3aR,7aR)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(oxazinan-2-yl)methanone.
| Compound Name | [(2R,3aR,7aR)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(oxazinan-2-yl)methanone |
|---|---|
| PubChem CID | 124804747 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [(2R,3aR,7aR)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-2-yl]-(oxazinan-2-yl)methanone |
| SMILES | Cc1nc(CN2CC[C@@H]3C[C@H](C(=O)N4CCCCO4)O[C@H]3C2)cs1 |
| InChI | InChI=1S/C17H25N3O3S/c1-12-18-14(11-24-12)9-19-6-4-13-8-15(23-16(13)10-19)17(21)20-5-2-3-7-22-20/h11,13,15-16H,2-10H2,1H3/t13-,15-,16+/m1/s1 |
| InChIKey | WBSLPLRGTQRUSA-BMFZPTHFSA-N |
| XLogP | 1.98 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |