C17H21N3O — CID 124804817
(3aR,6aS)-1-(furan-3-ylmethyl)-4-(pyridin-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 124804817) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is (3aR,6aS)-1-(furan-3-ylmethyl)-4-(pyridin-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aR,6aS)-1-(furan-3-ylmethyl)-4-(pyridin-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 124804817 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (3aR,6aS)-1-(furan-3-ylmethyl)-4-(pyridin-2-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | c1ccc(CN2CC[C@H]3[C@H]2CCN3Cc2ccoc2)nc1 |
| InChI | InChI=1S/C17H21N3O/c1-2-7-18-15(3-1)12-20-9-5-16-17(20)4-8-19(16)11-14-6-10-21-13-14/h1-3,6-7,10,13,16-17H,4-5,8-9,11-12H2/t16-,17+/m0/s1 |
| InChIKey | WNCFHEYSXVRNPV-DLBZAZTESA-N |
| XLogP | 2.52 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |