C14H20N2OS — CID 124804906
2-methyl-4-[[(1R,4S,7S)-7-prop-2-enoxy-2-azabicyclo[2.2.1]heptan-2-yl]methyl]-1,3-thiazole (PubChem CID 124804906) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-methyl-4-[[(1R,4S,7S)-7-prop-2-enoxy-2-azabicyclo[2.2.1]heptan-2-yl]methyl]-1,3-thiazole.
| Compound Name | 2-methyl-4-[[(1R,4S,7S)-7-prop-2-enoxy-2-azabicyclo[2.2.1]heptan-2-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 124804906 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-methyl-4-[[(1R,4S,7S)-7-prop-2-enoxy-2-azabicyclo[2.2.1]heptan-2-yl]methyl]-1,3-thiazole |
| SMILES | C=CCO[C@H]1[C@H]2CC[C@H]1N(Cc1csc(C)n1)C2 |
| InChI | InChI=1S/C14H20N2OS/c1-3-6-17-14-11-4-5-13(14)16(7-11)8-12-9-18-10(2)15-12/h3,9,11,13-14H,1,4-8H2,2H3/t11-,13+,14-/m0/s1 |
| InChIKey | WTNTWCSMVXJETF-YUTCNCBUSA-N |
| XLogP | 2.62 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|