C16H22N4OS2 — CID 124805166
(5aR,8aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine (PubChem CID 124805166) has the molecular formula C16H22N4OS2 and a molecular weight of 350.51 g/mol. Its IUPAC name is (5aR,8aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine.
| Compound Name | (5aR,8aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
|---|---|
| PubChem CID | 124805166 |
| Molecular Formula | C16H22N4OS2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (5aR,8aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
| SMILES | Cc1nc(CN2CCO[C@H]3CN(Cc4nccs4)C[C@H]3C2)cs1 |
| InChI | InChI=1S/C16H22N4OS2/c1-12-18-14(11-23-12)8-19-3-4-21-15-9-20(7-13(15)6-19)10-16-17-2-5-22-16/h2,5,11,13,15H,3-4,6-10H2,1H3/t13-,15+/m1/s1 |
| InChIKey | YSOSOXIOUQFBHX-HIFRSBDPSA-N |
| XLogP | 2.24 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |