C15H24N4O2 — CID 124805421
(2S,3aR,7aS)-N,N-dimethyl-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide (PubChem CID 124805421) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (2S,3aR,7aS)-N,N-dimethyl-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide.
| Compound Name | (2S,3aR,7aS)-N,N-dimethyl-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 124805421 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (2S,3aR,7aS)-N,N-dimethyl-6-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1C[C@H]2CCN(Cc3cnn(C)c3)C[C@H]2O1 |
| InChI | InChI=1S/C15H24N4O2/c1-17(2)15(20)13-6-12-4-5-19(10-14(12)21-13)9-11-7-16-18(3)8-11/h7-8,12-14H,4-6,9-10H2,1-3H3/t12-,13+,14-/m1/s1 |
| InChIKey | KWWUYYFMHKAVSZ-HZSPNIEDSA-N |
| XLogP | 0.49 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |