C18H23NO5S — CID 124805887
(2S,3aS,8aS)-3a-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3,5,6,7,8,8a-hexahydro-2H-cyclohepta[b]pyrrole-2-carboxylic acid (PubChem CID 124805887) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is (2S,3aS,8aS)-3a-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3,5,6,7,8,8a-hexahydro-2H-cyclohepta[b]pyrrole-2-carboxylic acid.
| Compound Name | (2S,3aS,8aS)-3a-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3,5,6,7,8,8a-hexahydro-2H-cyclohepta[b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 124805887 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (2S,3aS,8aS)-3a-methyl-1-(4-methylphenyl)sulfonyl-4-oxo-3,5,6,7,8,8a-hexahydro-2H-cyclohepta[b]pyrrole-2-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H]3CCCCC(=O)[C@@]3(C)C[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C18H23NO5S/c1-12-7-9-13(10-8-12)25(23,24)19-14(17(21)22)11-18(2)15(19)5-3-4-6-16(18)20/h7-10,14-15H,3-6,11H2,1-2H3,(H,21,22)/t14-,15-,18-/m0/s1 |
| InChIKey | AWKQSOBJXCGMOA-MPGHIAIKSA-N |
| XLogP | 2.36 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |