C17H21FN4OS — CID 124806984
4-[[(3aR,6aR)-2-(5-fluoropyrimidin-2-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole (PubChem CID 124806984) has the molecular formula C17H21FN4OS and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-[[(3aR,6aR)-2-(5-fluoropyrimidin-2-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[(3aR,6aR)-2-(5-fluoropyrimidin-2-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 124806984 |
| Molecular Formula | C17H21FN4OS |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-[[(3aR,6aR)-2-(5-fluoropyrimidin-2-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(COC[C@]23CCC[C@H]2CN(c2ncc(F)cn2)C3)cs1 |
| InChI | InChI=1S/C17H21FN4OS/c1-12-21-15(9-24-12)8-23-11-17-4-2-3-13(17)7-22(10-17)16-19-5-14(18)6-20-16/h5-6,9,13H,2-4,7-8,10-11H2,1H3/t13-,17+/m0/s1 |
| InChIKey | DMLCKUHVOHTWMR-SUMWQHHRSA-N |
| XLogP | 3.20 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |