C17H24FN5O2 — CID 124807592
(3aR,7aR)-1-(5-fluoropyrimidin-2-yl)-4-(2-morpholin-4-ylethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 124807592) has the molecular formula C17H24FN5O2 and a molecular weight of 349.41 g/mol. Its IUPAC name is (3aR,7aR)-1-(5-fluoropyrimidin-2-yl)-4-(2-morpholin-4-ylethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aR,7aR)-1-(5-fluoropyrimidin-2-yl)-4-(2-morpholin-4-ylethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 124807592 |
| Molecular Formula | C17H24FN5O2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | (3aR,7aR)-1-(5-fluoropyrimidin-2-yl)-4-(2-morpholin-4-ylethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | O=C1CC[C@@H]2[C@@H](CCN2c2ncc(F)cn2)N1CCN1CCOCC1 |
| InChI | InChI=1S/C17H24FN5O2/c18-13-11-19-17(20-12-13)23-4-3-15-14(23)1-2-16(24)22(15)6-5-21-7-9-25-10-8-21/h11-12,14-15H,1-10H2/t14-,15-/m1/s1 |
| InChIKey | VRRUVWRXKVFKRF-HUUCEWRRSA-N |
| XLogP | 0.52 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |