C16H20O3 — CID 124807724
(1R,2R,7R,8R,10R)-4,10-dihydroxy-3,5,8,10-tetramethyltricyclo[6.2.2.02,7]dodeca-3,5,11-trien-9-one (PubChem CID 124807724) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (1R,2R,7R,8R,10R)-4,10-dihydroxy-3,5,8,10-tetramethyltricyclo[6.2.2.02,7]dodeca-3,5,11-trien-9-one.
| Compound Name | (1R,2R,7R,8R,10R)-4,10-dihydroxy-3,5,8,10-tetramethyltricyclo[6.2.2.02,7]dodeca-3,5,11-trien-9-one |
|---|---|
| PubChem CID | 124807724 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (1R,2R,7R,8R,10R)-4,10-dihydroxy-3,5,8,10-tetramethyltricyclo[6.2.2.02,7]dodeca-3,5,11-trien-9-one |
| SMILES | CC1=C[C@@H]2[C@@H](C(C)=C1O)[C@H]1C=C[C@@]2(C)C(=O)[C@]1(C)O |
| InChI | InChI=1S/C16H20O3/c1-8-7-11-12(9(2)13(8)17)10-5-6-15(11,3)14(18)16(10,4)19/h5-7,10-12,17,19H,1-4H3/t10-,11-,12+,15-,16-/m1/s1 |
| InChIKey | JHOZTHANDINZKA-ZTJZGAFRSA-N |
| XLogP | 2.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|