C19H25NO5S — CID 124809697
ethyl (2S,3aS,8aR)-1-(4-methylphenyl)sulfonyl-4-oxo-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate (PubChem CID 124809697) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is ethyl (2S,3aS,8aR)-1-(4-methylphenyl)sulfonyl-4-oxo-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate.
| Compound Name | ethyl (2S,3aS,8aR)-1-(4-methylphenyl)sulfonyl-4-oxo-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 124809697 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | ethyl (2S,3aS,8aR)-1-(4-methylphenyl)sulfonyl-4-oxo-2,3,3a,5,6,7,8,8a-octahydrocyclohepta[b]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]2C(=O)CCCC[C@H]2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H25NO5S/c1-3-25-19(22)17-12-15-16(6-4-5-7-18(15)21)20(17)26(23,24)14-10-8-13(2)9-11-14/h8-11,15-17H,3-7,12H2,1-2H3/t15-,16+,17-/m0/s1 |
| InChIKey | QBYPKINOCXNXSV-BBWFWOEESA-N |
| XLogP | 2.45 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |