C17H24N4O2S — CID 124810192
(4aR,7R,7aR)-4-[(3-methylimidazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 124810192) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is (4aR,7R,7aR)-4-[(3-methylimidazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aR,7R,7aR)-4-[(3-methylimidazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 124810192 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (4aR,7R,7aR)-4-[(3-methylimidazol-4-yl)methyl]-7-(1,3-thiazol-2-ylmethoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | Cn1cncc1CN1CCO[C@@H]2[C@@H](COCc3nccs3)CC[C@H]21 |
| InChI | InChI=1S/C17H24N4O2S/c1-20-12-18-8-14(20)9-21-5-6-23-17-13(2-3-15(17)21)10-22-11-16-19-4-7-24-16/h4,7-8,12-13,15,17H,2-3,5-6,9-11H2,1H3/t13-,15-,17-/m1/s1 |
| InChIKey | MXKPMVVSWDMMLY-FRFSOERESA-N |
| XLogP | 2.07 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |