C18H27N3O2S — CID 124810361
[(4S,4aR,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 124810361) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is [(4S,4aR,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(4S,4aR,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 124810361 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | [(4S,4aR,8aS)-6-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1ncsc1CN1CC[C@@H]2OCC[C@H](C(=O)N3CCCC3)[C@@H]2C1 |
| InChI | InChI=1S/C18H27N3O2S/c1-13-17(24-12-19-13)11-20-8-4-16-15(10-20)14(5-9-23-16)18(22)21-6-2-3-7-21/h12,14-16H,2-11H2,1H3/t14-,15-,16-/m0/s1 |
| InChIKey | OCFSJVLZYRRHLM-JYJNAYRXSA-N |
| XLogP | 2.30 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |