C23H29N3O2 — CID 124810644
(1R,4R,7R,10S,11S,17S,18R,21S,24R,25S)-14-methyl-12,14,16-triazaoctacyclo[16.5.1.14,7.02,17.03,11.012,16.021,24.010,25]pentacos-2-ene-13,15-dione (PubChem CID 124810644) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is (1R,4R,7R,10S,11S,17S,18R,21S,24R,25S)-14-methyl-12,14,16-triazaoctacyclo[16.5.1.14,7.02,17.03,11.012,16.021,24.010,25]pentacos-2-ene-13,15-dione.
| Compound Name | (1R,4R,7R,10S,11S,17S,18R,21S,24R,25S)-14-methyl-12,14,16-triazaoctacyclo[16.5.1.14,7.02,17.03,11.012,16.021,24.010,25]pentacos-2-ene-13,15-dione |
|---|---|
| PubChem CID | 124810644 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (1R,4R,7R,10S,11S,17S,18R,21S,24R,25S)-14-methyl-12,14,16-triazaoctacyclo[16.5.1.14,7.02,17.03,11.012,16.021,24.010,25]pentacos-2-ene-13,15-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1C(=C3[C@@H]2[C@@H]2CC[C@@H]4CC[C@@H]3[C@@H]42)[C@@H]2CC[C@@H]3CC[C@H]1[C@@H]32 |
| InChI | InChI=1S/C23H29N3O2/c1-24-22(27)25-20-14-8-4-10-2-6-12(16(10)14)18(20)19-13-7-3-11-5-9-15(17(11)13)21(19)26(25)23(24)28/h10-17,20-21H,2-9H2,1H3/t10-,11+,12-,13-,14+,15-,16+,17-,20+,21+/m1/s1 |
| InChIKey | OQPJCJPJPNWQBN-LDEXNAQYSA-N |
| XLogP | 2.87 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|