C21H22N4O2 — CID 124810746
(1S)-N-[4-[(2S)-1-methyl-4-oxo-2,3-dihydropyrido[2,3-d]pyrimidin-2-yl]phenyl]cyclohex-3-ene-1-carboxamide (PubChem CID 124810746) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (1S)-N-[4-[(2S)-1-methyl-4-oxo-2,3-dihydropyrido[2,3-d]pyrimidin-2-yl]phenyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[4-[(2S)-1-methyl-4-oxo-2,3-dihydropyrido[2,3-d]pyrimidin-2-yl]phenyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 124810746 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1S)-N-[4-[(2S)-1-methyl-4-oxo-2,3-dihydropyrido[2,3-d]pyrimidin-2-yl]phenyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CN1c2ncccc2C(=O)N[C@@H]1c1ccc(NC(=O)[C@@H]2CC=CCC2)cc1 |
| InChI | InChI=1S/C21H22N4O2/c1-25-18(24-21(27)17-8-5-13-22-19(17)25)14-9-11-16(12-10-14)23-20(26)15-6-3-2-4-7-15/h2-3,5,8-13,15,18H,4,6-7H2,1H3,(H,23,26)(H,24,27)/t15-,18+/m1/s1 |
| InChIKey | PALCAFZJRGNDJD-QAPCUYQASA-N |
| XLogP | 3.25 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|