C22H30ClN3O2 — CID 124810877
(3aR,6aS)-1'-(3-chlorobenzoyl)-2-methyl-5-(2-methylpropyl)spiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one (PubChem CID 124810877) has the molecular formula C22H30ClN3O2 and a molecular weight of 403.95 g/mol. Its IUPAC name is (3aR,6aS)-1'-(3-chlorobenzoyl)-2-methyl-5-(2-methylpropyl)spiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one.
| Compound Name | (3aR,6aS)-1'-(3-chlorobenzoyl)-2-methyl-5-(2-methylpropyl)spiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 124810877 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (3aR,6aS)-1'-(3-chlorobenzoyl)-2-methyl-5-(2-methylpropyl)spiro[3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,4'-piperidine]-1-one |
| SMILES | CC(C)CN1C[C@H]2C(=O)N(C)C3(CCN(C(=O)c4cccc(Cl)c4)CC3)[C@H]2C1 |
| InChI | InChI=1S/C22H30ClN3O2/c1-15(2)12-25-13-18-19(14-25)22(24(3)21(18)28)7-9-26(10-8-22)20(27)16-5-4-6-17(23)11-16/h4-6,11,15,18-19H,7-10,12-14H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | PMTBGGUBSGBUSN-MOPGFXCFSA-N |
| XLogP | 2.99 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |