C18H28N2OS — CID 124811407
(3R,3aS,7aS)-5-[(5-methylthiophen-2-yl)methyl]-3-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine (PubChem CID 124811407) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is (3R,3aS,7aS)-5-[(5-methylthiophen-2-yl)methyl]-3-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine.
| Compound Name | (3R,3aS,7aS)-5-[(5-methylthiophen-2-yl)methyl]-3-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
|---|---|
| PubChem CID | 124811407 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (3R,3aS,7aS)-5-[(5-methylthiophen-2-yl)methyl]-3-(pyrrolidin-1-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine |
| SMILES | Cc1ccc(CN2CC[C@@H]3CO[C@@H](CN4CCCC4)[C@@H]3C2)s1 |
| InChI | InChI=1S/C18H28N2OS/c1-14-4-5-16(22-14)10-20-9-6-15-13-21-18(17(15)11-20)12-19-7-2-3-8-19/h4-5,15,17-18H,2-3,6-13H2,1H3/t15-,17-,18+/m1/s1 |
| InChIKey | BBPOAKGPXYBNCD-NXHRZFHOSA-N |
| XLogP | 2.99 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |